C13H11FN4O — CID 137083665
11-fluoro-3-methyl-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one (PubChem CID 137083665) has the molecular formula C13H11FN4O and a molecular weight of 258.26 g/mol. Its IUPAC name is 11-fluoro-3-methyl-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one.
| Compound Name | 11-fluoro-3-methyl-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one |
|---|---|
| PubChem CID | 137083665 |
| Molecular Formula | C13H11FN4O |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 11-fluoro-3-methyl-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one |
| SMILES | CN1Cc2nnc(=O)c3cc(F)cc4c3c2C(C1)N4 |
| InChI | InChI=1S/C13H11FN4O/c1-18-4-9-12-10(5-18)16-17-13(19)7-2-6(14)3-8(15-9)11(7)12/h2-3,9,15H,4-5H2,1H3 |
| InChIKey | RHJBTRBWYIORDV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |