C14H13FN4O — CID 137083668
3-ethyl-11-fluoro-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one (PubChem CID 137083668) has the molecular formula C14H13FN4O and a molecular weight of 272.28 g/mol. Its IUPAC name is 3-ethyl-11-fluoro-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one.
| Compound Name | 3-ethyl-11-fluoro-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one |
|---|---|
| PubChem CID | 137083668 |
| Molecular Formula | C14H13FN4O |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3-ethyl-11-fluoro-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one |
| SMILES | CCN1Cc2nnc(=O)c3cc(F)cc4c3c2C(C1)N4 |
| InChI | InChI=1S/C14H13FN4O/c1-2-19-5-10-13-11(6-19)17-18-14(20)8-3-7(15)4-9(16-10)12(8)13/h3-4,10,16H,2,5-6H2,1H3 |
| InChIKey | DJUQMSYRMFJEDJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |