About 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol
2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol (PubChem CID 137084455) has the molecular formula C24H14N2O2S
and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol |
| PubChem CID | 137084455 |
| Molecular Formula | C24H14N2O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc2c(o1)c(-c1nc3ccccc3s1)cc1ccccc12 |
| InChI | InChI=1S/C24H14N2O2S/c27-19-11-5-3-9-16(19)23-26-21-15-8-2-1-7-14(15)13-17(22(21)28-23)24-25-18-10-4-6-12-20(18)29-24/h1-13,27H |
| InChIKey | BNJQYQQRWXQJGV-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol?
The IUPAC name of 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol (CID 137084455) is 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol.
What is the SMILES notation for 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol?
The canonical SMILES for 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol is Oc1ccccc1-c1nc2c(o1)c(-c1nc3ccccc3s1)cc1ccccc12.
What is the InChIKey of 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol?
The InChIKey is BNJQYQQRWXQJGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14N2O2S/c27-19-11-5-3-9-16(19)23-26-21-15-8-2-1-7-14(15)13-17(22(21)28-23)24-25-18-10-4-6-12-20(18)29-24/h1-13,27H.
What are the key properties of 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol?
2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol has a molecular weight of 394.46 g/mol, XLogP of 6.63, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-benzothiazol-2-yl)benzo[e][1,3]benzoxazol-2-yl]phenol is sourced from PubChem (CID 137084455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).