C21H21F3N6O4 — CID 137084611
N-[2-(2,3-dihydroxypropoxy)-1,2,3,4-tetrahydropyrazin-5-yl]-6-[2-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 137084611) has the molecular formula C21H21F3N6O4 and a molecular weight of 478.43 g/mol. Its IUPAC name is N-[2-(2,3-dihydroxypropoxy)-1,2,3,4-tetrahydropyrazin-5-yl]-6-[2-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | N-[2-(2,3-dihydroxypropoxy)-1,2,3,4-tetrahydropyrazin-5-yl]-6-[2-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 137084611 |
| Molecular Formula | C21H21F3N6O4 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[2-(2,3-dihydroxypropoxy)-1,2,3,4-tetrahydropyrazin-5-yl]-6-[2-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | O=C(NC1=CNC(OCC(O)CO)CN1)c1cnc2ccc(-c3ccccc3C(F)(F)F)nn12 |
| InChI | InChI=1S/C21H21F3N6O4/c22-21(23,24)14-4-2-1-3-13(14)15-5-6-18-26-7-16(30(18)29-15)20(33)28-17-8-27-19(9-25-17)34-11-12(32)10-31/h1-8,12,19,25,27,31-32H,9-11H2,(H,28,33) |
| InChIKey | RXYXBTXZWVWKME-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |