C9H14N2 — CID 137084627
N,3,6-trimethyl-1,3-dihydroazepin-2-imine (PubChem CID 137084627) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N,3,6-trimethyl-1,3-dihydroazepin-2-imine.
| Compound Name | N,3,6-trimethyl-1,3-dihydroazepin-2-imine |
|---|---|
| PubChem CID | 137084627 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N,3,6-trimethyl-1,3-dihydroazepin-2-imine |
| SMILES | C/N=C1\NC=C(C)C=CC1C |
| InChI | InChI=1S/C9H14N2/c1-7-4-5-8(2)9(10-3)11-6-7/h4-6,8H,1-3H3,(H,10,11) |
| InChIKey | BZDALYJWIOOQMJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|