C8H11N5O4 — CID 137084781
N-[4-(ethylamino)-5-nitro-6-oxo-1H-pyrimidin-2-yl]acetamide (PubChem CID 137084781) has the molecular formula C8H11N5O4 and a molecular weight of 241.21 g/mol. Its IUPAC name is N-[4-(ethylamino)-5-nitro-6-oxo-1H-pyrimidin-2-yl]acetamide.
| Compound Name | N-[4-(ethylamino)-5-nitro-6-oxo-1H-pyrimidin-2-yl]acetamide |
|---|---|
| PubChem CID | 137084781 |
| Molecular Formula | C8H11N5O4 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | N-[4-(ethylamino)-5-nitro-6-oxo-1H-pyrimidin-2-yl]acetamide |
| SMILES | CCNc1nc(NC(C)=O)[nH]c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N5O4/c1-3-9-6-5(13(16)17)7(15)12-8(11-6)10-4(2)14/h3H2,1-2H3,(H3,9,10,11,12,14,15) |
| InChIKey | ONPDNAWPVOLCPL-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|