C24H24ClNO3 — CID 137085696
3-[[5-(1-adamantyl)-2-hydroxyphenyl]methylideneamino]-4-chlorobenzoic acid (PubChem CID 137085696) has the molecular formula C24H24ClNO3 and a molecular weight of 409.91 g/mol. Its IUPAC name is 3-[[5-(1-adamantyl)-2-hydroxyphenyl]methylideneamino]-4-chlorobenzoic acid.
| Compound Name | 3-[[5-(1-adamantyl)-2-hydroxyphenyl]methylideneamino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 137085696 |
| Molecular Formula | C24H24ClNO3 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 3-[[5-(1-adamantyl)-2-hydroxyphenyl]methylideneamino]-4-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(/N=C/c2cc(C34CC5CC(CC(C5)C3)C4)ccc2O)c1 |
| InChI | InChI=1S/C24H24ClNO3/c25-20-3-1-17(23(28)29)9-21(20)26-13-18-8-19(2-4-22(18)27)24-10-14-5-15(11-24)7-16(6-14)12-24/h1-4,8-9,13-16,27H,5-7,10-12H2,(H,28,29)/b26-13+ |
| InChIKey | SSBHMVZDZCFJKI-LGJNPRDNSA-N |
| XLogP | 5.96 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|