About CID 137086436
CID 137086436 (PubChem CID 137086436) has the molecular formula C50H66S12Si2
and a molecular weight of 1108.05 g/mol.
Molecular Properties
| Compound Name | CID 137086436 |
| PubChem CID | 137086436 |
| Molecular Formula | C50H66S12Si2 |
| Molecular Weight | 1108.05 g/mol |
| Exact Mass | 1106.14 |
| IUPAC Name | — |
| SMILES | CCCCSC1=C(SCCCC)SC(=C2SC=C(C#CC(C#CC3=CSC(=C4SC(SCCCC)=C(SCCCC)S4)S3)=C(C#C[Si](C(C)C)C(C)C)C#C[Si](C(C)C)C(C)C)S2)S1 |
| InChI | InChI=1S/C50H66S12Si2/c1-13-17-27-51-43-44(52-28-18-14-2)60-49(59-43)47-55-33-41(57-47)23-21-39(40(25-31-63(35(5)6)36(7)8)26-32-64(37(9)10)38(11)12)22-24-42-34-56-48(58-42)50-61-45(53-29-19-15-3)46(62-50)54-30-20-16-4/h33-38H,13-20,27-30H2,1-12H3 |
| InChIKey | FZPPWHJNVJNTDX-UHFFFAOYSA-N |
| XLogP | 20.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1108.05 |
| LogP ≤ 5 | 20.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 137086436 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137086436?
The IUPAC name of CID 137086436 (CID 137086436) is not available.
What is the SMILES notation for CID 137086436?
The canonical SMILES for CID 137086436 is CCCCSC1=C(SCCCC)SC(=C2SC=C(C#CC(C#CC3=CSC(=C4SC(SCCCC)=C(SCCCC)S4)S3)=C(C#C[Si](C(C)C)C(C)C)C#C[Si](C(C)C)C(C)C)S2)S1.
What is the InChIKey of CID 137086436?
The InChIKey is FZPPWHJNVJNTDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C50H66S12Si2/c1-13-17-27-51-43-44(52-28-18-14-2)60-49(59-43)47-55-33-41(57-47)23-21-39(40(25-31-63(35(5)6)36(7)8)26-32-64(37(9)10)38(11)12)22-24-42-34-56-48(58-42)50-61-45(53-29-19-15-3)46(62-50)54-30-20-16-4/h33-38H,13-20,27-30H2,1-12H3.
What are the key properties of CID 137086436?
CID 137086436 has a molecular weight of 1108.05 g/mol, XLogP of 20.25, 20 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137086436 is sourced from PubChem (CID 137086436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).