C19H22FN7S — CID 137086858
4-(4-amino-2-fluorophenyl)-N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]piperazine-1-carbothioamide (PubChem CID 137086858) has the molecular formula C19H22FN7S and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-(4-amino-2-fluorophenyl)-N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]piperazine-1-carbothioamide.
| Compound Name | 4-(4-amino-2-fluorophenyl)-N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 137086858 |
| Molecular Formula | C19H22FN7S |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-(4-amino-2-fluorophenyl)-N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]piperazine-1-carbothioamide |
| SMILES | Nc1ccc(N2CCN(C(=S)N/N=C3/CCNc4cccnc43)CC2)c(F)c1 |
| InChI | InChI=1S/C19H22FN7S/c20-14-12-13(21)3-4-17(14)26-8-10-27(11-9-26)19(28)25-24-16-5-7-22-15-2-1-6-23-18(15)16/h1-4,6,12,22H,5,7-11,21H2,(H,25,28)/b24-16- |
| InChIKey | RYYQBNSZXRNENA-JLPGSUDCSA-N |
| XLogP | 2.02 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|