C15H19FN6S — CID 137086864
4-ethenyl-N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide (PubChem CID 137086864) has the molecular formula C15H19FN6S and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-ethenyl-N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide.
| Compound Name | 4-ethenyl-N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 137086864 |
| Molecular Formula | C15H19FN6S |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-ethenyl-N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide |
| SMILES | C=CN1CCN(C(=S)N/N=C2/CCNc3cc(F)cnc32)CC1 |
| InChI | InChI=1S/C15H19FN6S/c1-2-21-5-7-22(8-6-21)15(23)20-19-12-3-4-17-13-9-11(16)10-18-14(12)13/h2,9-10,17H,1,3-8H2,(H,20,23)/b19-12- |
| InChIKey | DWIYDASRXAURRG-UNOMPAQXSA-N |
| XLogP | 1.38 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|