C18H20FN7S — CID 137086866
N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-3-ylpiperazine-1-carbothioamide (PubChem CID 137086866) has the molecular formula C18H20FN7S and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-3-ylpiperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-3-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 137086866 |
| Molecular Formula | C18H20FN7S |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-3-ylpiperazine-1-carbothioamide |
| SMILES | Fc1cnc2c(c1)NCC/C2=N/NC(=S)N1CCN(c2cccnc2)CC1 |
| InChI | InChI=1S/C18H20FN7S/c19-13-10-16-17(22-11-13)15(3-5-21-16)23-24-18(27)26-8-6-25(7-9-26)14-2-1-4-20-12-14/h1-2,4,10-12,21H,3,5-9H2,(H,24,27)/b23-15- |
| InChIKey | PHWSLSMORQAVDF-HAHDFKILSA-N |
| XLogP | 1.83 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|