C26H22ClN3O2 — CID 137089462
(1R,2S,6S,7R)-4-[(Z)-[2-[(4-chlorophenyl)methyl]-1H-indol-3-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 137089462) has the molecular formula C26H22ClN3O2 and a molecular weight of 443.93 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-[(Z)-[2-[(4-chlorophenyl)methyl]-1H-indol-3-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-4-[(Z)-[2-[(4-chlorophenyl)methyl]-1H-indol-3-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 137089462 |
| Molecular Formula | C26H22ClN3O2 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (1R,2S,6S,7R)-4-[(Z)-[2-[(4-chlorophenyl)methyl]-1H-indol-3-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1/N=C\c1c(Cc3ccc(Cl)cc3)[nH]c3ccccc13)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C26H22ClN3O2/c27-18-11-5-15(6-12-18)13-22-20(19-3-1-2-4-21(19)29-22)14-28-30-25(31)23-16-7-8-17(10-9-16)24(23)26(30)32/h1-8,11-12,14,16-17,23-24,29H,9-10,13H2/b28-14-/t16-,17-,23-,24-/m0/s1 |
| InChIKey | VGTSZFTUOBXGEX-YYQGBSKUSA-N |
| XLogP | 4.94 |
| TPSA | 65.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|