C17H14F5NO2 — CID 1370898
6-(1,1,2,2,2-pentafluoroethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one (PubChem CID 1370898) has the molecular formula C17H14F5NO2 and a molecular weight of 359.29 g/mol. Its IUPAC name is 6-(1,1,2,2,2-pentafluoroethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one.
| Compound Name | 6-(1,1,2,2,2-pentafluoroethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
|---|---|
| PubChem CID | 1370898 |
| Molecular Formula | C17H14F5NO2 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 6-(1,1,2,2,2-pentafluoroethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
| SMILES | O=c1cc(C(F)(F)C(F)(F)F)c2cc3c4c(c2o1)CCCN4CCC3 |
| InChI | InChI=1S/C17H14F5NO2/c18-16(19,17(20,21)22)12-8-13(24)25-15-10-4-2-6-23-5-1-3-9(14(10)23)7-11(12)15/h7-8H,1-6H2 |
| InChIKey | UFWKKOKRFRZWMG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|