About 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride
3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride (PubChem CID 137091117) has the molecular formula C7H12ClN5O
and a molecular weight of 217.66 g/mol. Its IUPAC name is 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride.
Molecular Properties
| Compound Name | 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride |
| PubChem CID | 137091117 |
| Molecular Formula | C7H12ClN5O |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride |
| SMILES | Cl.O=c1cnnc(N2CCNCC2)[nH]1 |
| InChI | InChI=1S/C7H11N5O.ClH/c13-6-5-9-11-7(10-6)12-3-1-8-2-4-12;/h5,8H,1-4H2,(H,10,11,13);1H |
| InChIKey | MNUFOKMRDJFRMA-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride?
The IUPAC name of 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride (CID 137091117) is 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride.
What is the SMILES notation for 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride?
The canonical SMILES for 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride is Cl.O=c1cnnc(N2CCNCC2)[nH]1.
What is the InChIKey of 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride?
The InChIKey is MNUFOKMRDJFRMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5O.ClH/c13-6-5-9-11-7(10-6)12-3-1-8-2-4-12;/h5,8H,1-4H2,(H,10,11,13);1H.
What are the key properties of 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride?
3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride has a molecular weight of 217.66 g/mol, XLogP of -1.00, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperazin-1-yl-4H-1,2,4-triazin-5-one;hydrochloride is sourced from PubChem (CID 137091117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).