About 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride
3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride (PubChem CID 137091118) has the molecular formula C8H14ClN5O
and a molecular weight of 231.69 g/mol. Its IUPAC name is 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride |
| PubChem CID | 137091118 |
| Molecular Formula | C8H14ClN5O |
| Molecular Weight | 231.69 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride |
| SMILES | Cl.NC1CCN(c2nncc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C8H13N5O.ClH/c9-6-1-3-13(4-2-6)8-11-7(14)5-10-12-8;/h5-6H,1-4,9H2,(H,11,12,14);1H |
| InChIKey | DRTBWVSJIHJVFB-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.69 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride?
The IUPAC name of 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride (CID 137091118) is 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride.
What is the SMILES notation for 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride?
The canonical SMILES for 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride is Cl.NC1CCN(c2nncc(=O)[nH]2)CC1.
What is the InChIKey of 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride?
The InChIKey is DRTBWVSJIHJVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O.ClH/c9-6-1-3-13(4-2-6)8-11-7(14)5-10-12-8;/h5-6H,1-4,9H2,(H,11,12,14);1H.
What are the key properties of 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride?
3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride has a molecular weight of 231.69 g/mol, XLogP of -0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminopiperidin-1-yl)-4H-1,2,4-triazin-5-one;hydrochloride is sourced from PubChem (CID 137091118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).