C15H11N3O2S — CID 137091128
(1Z)-3-methyl-1-(1,3-thiazol-2-ylimino)-3,4-dihydrofuro[3,4-b]quinolin-9-one (PubChem CID 137091128) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is (1Z)-3-methyl-1-(1,3-thiazol-2-ylimino)-3,4-dihydrofuro[3,4-b]quinolin-9-one.
| Compound Name | (1Z)-3-methyl-1-(1,3-thiazol-2-ylimino)-3,4-dihydrofuro[3,4-b]quinolin-9-one |
|---|---|
| PubChem CID | 137091128 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (1Z)-3-methyl-1-(1,3-thiazol-2-ylimino)-3,4-dihydrofuro[3,4-b]quinolin-9-one |
| SMILES | CC1O/C(=N\c2nccs2)c2c1[nH]c1ccccc1c2=O |
| InChI | InChI=1S/C15H11N3O2S/c1-8-12-11(14(20-8)18-15-16-6-7-21-15)13(19)9-4-2-3-5-10(9)17-12/h2-8H,1H3,(H,17,19)/b18-14- |
| InChIKey | QDAYCTRBLKUCGJ-JXAWBTAJSA-N |
| XLogP | 3.15 |
| TPSA | 67.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|