C23H25ClN4O2 — CID 137091337
6-[4-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butyl]-2-[(Z)-hydroxyiminomethyl]pyridin-3-ol (PubChem CID 137091337) has the molecular formula C23H25ClN4O2 and a molecular weight of 424.93 g/mol. Its IUPAC name is 6-[4-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butyl]-2-[(Z)-hydroxyiminomethyl]pyridin-3-ol.
| Compound Name | 6-[4-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butyl]-2-[(Z)-hydroxyiminomethyl]pyridin-3-ol |
|---|---|
| PubChem CID | 137091337 |
| Molecular Formula | C23H25ClN4O2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 6-[4-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butyl]-2-[(Z)-hydroxyiminomethyl]pyridin-3-ol |
| SMILES | O/N=C\c1nc(CCCCNc2c3c(nc4ccc(Cl)cc24)CCCC3)ccc1O |
| InChI | InChI=1S/C23H25ClN4O2/c24-15-8-10-20-18(13-15)23(17-6-1-2-7-19(17)28-20)25-12-4-3-5-16-9-11-22(29)21(27-16)14-26-30/h8-11,13-14,29-30H,1-7,12H2,(H,25,28)/b26-14- |
| InChIKey | AEGVBHAVNJPGMI-WGARJPEWSA-N |
| XLogP | 5.11 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|