C24H22N8O2 — CID 137091388
N-[2-[4-amino-3-[4-hydroxy-3-(methylamino)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-cyano-N-phenylprop-2-enamide (PubChem CID 137091388) has the molecular formula C24H22N8O2 and a molecular weight of 454.49 g/mol. Its IUPAC name is N-[2-[4-amino-3-[4-hydroxy-3-(methylamino)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-cyano-N-phenylprop-2-enamide.
| Compound Name | N-[2-[4-amino-3-[4-hydroxy-3-(methylamino)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-cyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 137091388 |
| Molecular Formula | C24H22N8O2 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-[2-[4-amino-3-[4-hydroxy-3-(methylamino)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-cyano-N-phenylprop-2-enamide |
| SMILES | C=C(C#N)C(=O)N(CCn1nc(-c2ccc(O)c(NC)c2)c2c(N)ncnc21)c1ccccc1 |
| InChI | InChI=1S/C24H22N8O2/c1-15(13-25)24(34)31(17-6-4-3-5-7-17)10-11-32-23-20(22(26)28-14-29-23)21(30-32)16-8-9-19(33)18(12-16)27-2/h3-9,12,14,27,33H,1,10-11H2,2H3,(H2,26,28,29) |
| InChIKey | MREAARZXXXUYRY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 145.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|