About N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide
N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide (PubChem CID 137092203) has the molecular formula C17H18N4O4
and a molecular weight of 342.36 g/mol. Its IUPAC name is N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide.
Molecular Properties
| Compound Name | N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide |
| PubChem CID | 137092203 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide |
| SMILES | CC1(C)OC(=O)C(C(N)=Nc2ccnn2Cc2ccccc2)=C(O)O1 |
| InChI | InChI=1S/C17H18N4O4/c1-17(2)24-15(22)13(16(23)25-17)14(18)20-12-8-9-19-21(12)10-11-6-4-3-5-7-11/h3-9,22H,10H2,1-2H3,(H2,18,20) |
| InChIKey | VKOLXOJNEQPMSI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide?
The IUPAC name of N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide (CID 137092203) is N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide.
What is the SMILES notation for N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide?
The canonical SMILES for N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide is CC1(C)OC(=O)C(C(N)=Nc2ccnn2Cc2ccccc2)=C(O)O1.
What is the InChIKey of N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide?
The InChIKey is VKOLXOJNEQPMSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O4/c1-17(2)24-15(22)13(16(23)25-17)14(18)20-12-8-9-19-21(12)10-11-6-4-3-5-7-11/h3-9,22H,10H2,1-2H3,(H2,18,20).
What are the key properties of N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide?
N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide has a molecular weight of 342.36 g/mol, XLogP of 2.00, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-benzylpyrazol-3-yl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide is sourced from PubChem (CID 137092203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).