About N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide
N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide (PubChem CID 137092313) has the molecular formula C13H13BrN2O4
and a molecular weight of 341.16 g/mol. Its IUPAC name is N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide.
Molecular Properties
| Compound Name | N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide |
| PubChem CID | 137092313 |
| Molecular Formula | C13H13BrN2O4 |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide |
| SMILES | CC1(C)OC(=O)C(/C(N)=N/c2ccc(Br)cc2)=C(O)O1 |
| InChI | InChI=1S/C13H13BrN2O4/c1-13(2)19-11(17)9(12(18)20-13)10(15)16-8-5-3-7(14)4-6-8/h3-6,17H,1-2H3,(H2,15,16) |
| InChIKey | KWMQXTDACORHNW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide?
The IUPAC name of N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide (CID 137092313) is N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide.
What is the SMILES notation for N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide?
The canonical SMILES for N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide is CC1(C)OC(=O)C(/C(N)=N/c2ccc(Br)cc2)=C(O)O1.
What is the InChIKey of N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide?
The InChIKey is KWMQXTDACORHNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN2O4/c1-13(2)19-11(17)9(12(18)20-13)10(15)16-8-5-3-7(14)4-6-8/h3-6,17H,1-2H3,(H2,15,16).
What are the key properties of N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide?
N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide has a molecular weight of 341.16 g/mol, XLogP of 2.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-bromophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboximidamide is sourced from PubChem (CID 137092313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).