About 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one
2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one (PubChem CID 137093193) has the molecular formula C17H12BrNO4S
and a molecular weight of 406.26 g/mol. Its IUPAC name is 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one.
Molecular Properties
| Compound Name | 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one |
| PubChem CID | 137093193 |
| Molecular Formula | C17H12BrNO4S |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one |
| SMILES | Cc1cc2cnc(/C=C/c3cc(O)c(O)c(Br)c3)sc-2c(O)c1=O |
| InChI | InChI=1S/C17H12BrNO4S/c1-8-4-10-7-19-13(24-17(10)16(23)14(8)21)3-2-9-5-11(18)15(22)12(20)6-9/h2-7,20,22-23H,1H3/b3-2+ |
| InChIKey | CXJYXDJBPZALLD-NSCUHMNNSA-N |
| XLogP | 3.97 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one?
The IUPAC name of 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one (CID 137093193) is 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one.
What is the SMILES notation for 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one?
The canonical SMILES for 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one is Cc1cc2cnc(/C=C/c3cc(O)c(O)c(Br)c3)sc-2c(O)c1=O.
What is the InChIKey of 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one?
The InChIKey is CXJYXDJBPZALLD-NSCUHMNNSA-N. The full InChI is InChI=1S/C17H12BrNO4S/c1-8-4-10-7-19-13(24-17(10)16(23)14(8)21)3-2-9-5-11(18)15(22)12(20)6-9/h2-7,20,22-23H,1H3/b3-2+.
What are the key properties of 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one?
2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one has a molecular weight of 406.26 g/mol, XLogP of 3.97, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(3-bromo-4,5-dihydroxyphenyl)ethenyl]-8-hydroxy-6-methyl-1,3-benzothiazin-7-one is sourced from PubChem (CID 137093193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).