C26H19F6N5OS — CID 137093463
5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-indazol-5-ylideneethyl]-2-(4-isocyanopiperidin-1-yl)-1,3-thiazol-4-ol (PubChem CID 137093463) has the molecular formula C26H19F6N5OS and a molecular weight of 563.53 g/mol. Its IUPAC name is 5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-indazol-5-ylideneethyl]-2-(4-isocyanopiperidin-1-yl)-1,3-thiazol-4-ol.
| Compound Name | 5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-indazol-5-ylideneethyl]-2-(4-isocyanopiperidin-1-yl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 137093463 |
| Molecular Formula | C26H19F6N5OS |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-indazol-5-ylideneethyl]-2-(4-isocyanopiperidin-1-yl)-1,3-thiazol-4-ol |
| SMILES | [C-]#[N+]C1CCN(c2nc(O)c(C(Cc3ccc(C(F)(F)F)cc3C(F)(F)F)=c3ccc4c(c3)C=NN=4)s2)CC1 |
| InChI | InChI=1S/C26H19F6N5OS/c1-33-18-6-8-37(9-7-18)24-35-23(38)22(39-24)19(14-3-5-21-16(10-14)13-34-36-21)11-15-2-4-17(25(27,28)29)12-20(15)26(30,31)32/h2-5,10,12-13,18,38H,6-9,11H2 |
| InChIKey | DEVJBOZOSMODPD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|