C23H21F3N4O5S — CID 137093637
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 137093637) has the molecular formula C23H21F3N4O5S and a molecular weight of 522.51 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 137093637 |
| Molecular Formula | C23H21F3N4O5S |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | COc1ccc(/N=C(\SCC(=O)Nc2cccc(C(F)(F)F)c2)c2c(O)n(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C23H21F3N4O5S/c1-29-20(32)18(21(33)30(2)22(29)34)19(28-14-7-9-16(35-3)10-8-14)36-12-17(31)27-15-6-4-5-13(11-15)23(24,25)26/h4-11,32H,12H2,1-3H3,(H,27,31)/b28-19- |
| InChIKey | QROCTKRDQOJGIP-USHMODERSA-N |
| XLogP | 3.27 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|