C22H20ClFN4O4S — CID 137094183
[2-(3-chloro-4-methylanilino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 137094183) has the molecular formula C22H20ClFN4O4S and a molecular weight of 490.94 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 137094183 |
| Molecular Formula | C22H20ClFN4O4S |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | Cc1ccc(NC(=O)CS/C(=N\c2ccc(F)cc2)c2c(O)n(C)c(=O)n(C)c2=O)cc1Cl |
| InChI | InChI=1S/C22H20ClFN4O4S/c1-12-4-7-15(10-16(12)23)25-17(29)11-33-19(26-14-8-5-13(24)6-9-14)18-20(30)27(2)22(32)28(3)21(18)31/h4-10,30H,11H2,1-3H3,(H,25,29)/b26-19- |
| InChIKey | YORCQKVOZRKZGA-XHPQRKPJSA-N |
| XLogP | 3.34 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|