C21H18ClN3O2 — CID 137094438
4-chloro-2-[4-(2-hydroxyphenyl)-2-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 137094438) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is 4-chloro-2-[4-(2-hydroxyphenyl)-2-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 4-chloro-2-[4-(2-hydroxyphenyl)-2-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 137094438 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-chloro-2-[4-(2-hydroxyphenyl)-2-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | Oc1ccccc1C1=NC(c2cccnc2)NC(c2cc(Cl)ccc2O)C1 |
| InChI | InChI=1S/C21H18ClN3O2/c22-14-7-8-20(27)16(10-14)18-11-17(15-5-1-2-6-19(15)26)24-21(25-18)13-4-3-9-23-12-13/h1-10,12,18,21,25-27H,11H2 |
| InChIKey | VCHHFFJNWJRHPR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|