C13H19N7O3 — CID 137094519
1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-3-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]urea (PubChem CID 137094519) has the molecular formula C13H19N7O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-3-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]urea.
| Compound Name | 1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-3-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 137094519 |
| Molecular Formula | C13H19N7O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-3-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]urea |
| SMILES | CCc1noc(CNC(=O)NCCNc2nc(C)cc(=O)[nH]2)n1 |
| InChI | InChI=1S/C13H19N7O3/c1-3-9-18-11(23-20-9)7-16-13(22)15-5-4-14-12-17-8(2)6-10(21)19-12/h6H,3-5,7H2,1-2H3,(H2,15,16,22)(H2,14,17,19,21) |
| InChIKey | SSHYLYAWKBFRHD-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 137.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|