C24H26N4O4 — CID 137094816
6-(6-butoxy-3-pyridinyl)-2-(5,6-dimethoxy-3-pyridinyl)-4-methylpyrrolo[3,4-b]pyridin-5-ol (PubChem CID 137094816) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 6-(6-butoxy-3-pyridinyl)-2-(5,6-dimethoxy-3-pyridinyl)-4-methylpyrrolo[3,4-b]pyridin-5-ol.
| Compound Name | 6-(6-butoxy-3-pyridinyl)-2-(5,6-dimethoxy-3-pyridinyl)-4-methylpyrrolo[3,4-b]pyridin-5-ol |
|---|---|
| PubChem CID | 137094816 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 6-(6-butoxy-3-pyridinyl)-2-(5,6-dimethoxy-3-pyridinyl)-4-methylpyrrolo[3,4-b]pyridin-5-ol |
| SMILES | CCCCOc1ccc(-n2cc3nc(-c4cnc(OC)c(OC)c4)cc(C)c3c2O)cn1 |
| InChI | InChI=1S/C24H26N4O4/c1-5-6-9-32-21-8-7-17(13-25-21)28-14-19-22(24(28)29)15(2)10-18(27-19)16-11-20(30-3)23(31-4)26-12-16/h7-8,10-14,29H,5-6,9H2,1-4H3 |
| InChIKey | SGJPXRGULLTXFV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|