About 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one
3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one (PubChem CID 137095242) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one.
Molecular Properties
| Compound Name | 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one |
| PubChem CID | 137095242 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one |
| SMILES | CCCCc1c[nH]c(=O)c2c(N)n[nH]c12 |
| InChI | InChI=1S/C10H14N4O/c1-2-3-4-6-5-12-10(15)7-8(6)13-14-9(7)11/h5H,2-4H2,1H3,(H,12,15)(H3,11,13,14) |
| InChIKey | IMBSHFKCBDJAPE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one?
The IUPAC name of 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one (CID 137095242) is 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one.
What is the SMILES notation for 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one?
The canonical SMILES for 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one is CCCCc1c[nH]c(=O)c2c(N)n[nH]c12.
What is the InChIKey of 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one?
The InChIKey is IMBSHFKCBDJAPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c1-2-3-4-6-5-12-10(15)7-8(6)13-14-9(7)11/h5H,2-4H2,1H3,(H,12,15)(H3,11,13,14).
What are the key properties of 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one?
3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one has a molecular weight of 206.25 g/mol, XLogP of 1.18, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-7-butyl-1,5-dihydropyrazolo[4,5-c]pyridin-4-one is sourced from PubChem (CID 137095242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).