C8H9N3O2 — CID 137095276
2-(5-methyl-6-oxo-1H-pyrimidin-4-yl)prop-2-enamide (PubChem CID 137095276) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-(5-methyl-6-oxo-1H-pyrimidin-4-yl)prop-2-enamide.
| Compound Name | 2-(5-methyl-6-oxo-1H-pyrimidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 137095276 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-(5-methyl-6-oxo-1H-pyrimidin-4-yl)prop-2-enamide |
| SMILES | C=C(C(N)=O)c1nc[nH]c(=O)c1C |
| InChI | InChI=1S/C8H9N3O2/c1-4(7(9)12)6-5(2)8(13)11-3-10-6/h3H,1H2,2H3,(H2,9,12)(H,10,11,13) |
| InChIKey | MJWOZXIXIXMSSP-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|