C9H13N5S — CID 137095834
6-cyclopentyl-1,5-dihydroimidazo[4,5-c][1,2,6]thiadiazin-4-amine (PubChem CID 137095834) has the molecular formula C9H13N5S and a molecular weight of 223.30 g/mol. Its IUPAC name is 6-cyclopentyl-1,5-dihydroimidazo[4,5-c][1,2,6]thiadiazin-4-amine.
| Compound Name | 6-cyclopentyl-1,5-dihydroimidazo[4,5-c][1,2,6]thiadiazin-4-amine |
|---|---|
| PubChem CID | 137095834 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 6-cyclopentyl-1,5-dihydroimidazo[4,5-c][1,2,6]thiadiazin-4-amine |
| SMILES | NC1=NSNc2nc(C3CCCC3)[nH]c21 |
| InChI | InChI=1S/C9H13N5S/c10-7-6-9(14-15-13-7)12-8(11-6)5-3-1-2-4-5/h5,14H,1-4H2,(H2,10,13)(H,11,12) |
| InChIKey | SLFPZEXUNCXTOM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|