C18H26N4O5 — CID 137097170
(E)-2-[3-(4-methyl-2-morpholin-4-yl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]hex-4-enoic acid (PubChem CID 137097170) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is (E)-2-[3-(4-methyl-2-morpholin-4-yl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]hex-4-enoic acid.
| Compound Name | (E)-2-[3-(4-methyl-2-morpholin-4-yl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]hex-4-enoic acid |
|---|---|
| PubChem CID | 137097170 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (E)-2-[3-(4-methyl-2-morpholin-4-yl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)CCc1c(C)nc(N2CCOCC2)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C18H26N4O5/c1-3-4-5-14(17(25)26)20-15(23)7-6-13-12(2)19-18(21-16(13)24)22-8-10-27-11-9-22/h3-4,14H,5-11H2,1-2H3,(H,20,23)(H,25,26)(H,19,21,24)/b4-3+ |
| InChIKey | CBYKMRRMCVCGQR-ONEGZZNKSA-N |
| XLogP | 0.38 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|