C12H19N3O4S — CID 137098143
1-[(6,7-dihydroxy-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl)methyl]pyrrolidin-2-one (PubChem CID 137098143) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 1-[(6,7-dihydroxy-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl)methyl]pyrrolidin-2-one.
| Compound Name | 1-[(6,7-dihydroxy-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 137098143 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 1-[(6,7-dihydroxy-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl)methyl]pyrrolidin-2-one |
| SMILES | C/N=C1/NC2C(OC(CN3CCCC3=O)C(O)C2O)S1 |
| InChI | InChI=1S/C12H19N3O4S/c1-13-12-14-8-10(18)9(17)6(19-11(8)20-12)5-15-4-2-3-7(15)16/h6,8-11,17-18H,2-5H2,1H3,(H,13,14) |
| InChIKey | CJUWZWKLEUERHE-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|