C18H18N6O — CID 137098996
11-(5-methoxy-1-methylindazol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraene (PubChem CID 137098996) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is 11-(5-methoxy-1-methylindazol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraene.
| Compound Name | 11-(5-methoxy-1-methylindazol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraene |
|---|---|
| PubChem CID | 137098996 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 11-(5-methoxy-1-methylindazol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraene |
| SMILES | COc1ccc2c(c1)c(-c1cc3c([nH]1)N=CC1=CNN(C)C13)nn2C |
| InChI | InChI=1S/C18H18N6O/c1-23-15-5-4-11(25-3)6-12(15)16(22-23)14-7-13-17-10(9-20-24(17)2)8-19-18(13)21-14/h4-9,17,20-21H,1-3H3 |
| InChIKey | SHBXPICKMOPYCI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |