C11H7N3OS2 — CID 137099069
4,6-dithiophen-2-yl-1H-1,3,5-triazin-2-one (PubChem CID 137099069) has the molecular formula C11H7N3OS2 and a molecular weight of 261.33 g/mol. Its IUPAC name is 4,6-dithiophen-2-yl-1H-1,3,5-triazin-2-one.
| Compound Name | 4,6-dithiophen-2-yl-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 137099069 |
| Molecular Formula | C11H7N3OS2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 4,6-dithiophen-2-yl-1H-1,3,5-triazin-2-one |
| SMILES | O=c1nc(-c2cccs2)nc(-c2cccs2)[nH]1 |
| InChI | InChI=1S/C11H7N3OS2/c15-11-13-9(7-3-1-5-16-7)12-10(14-11)8-4-2-6-17-8/h1-6H,(H,12,13,14,15) |
| InChIKey | PRTAWZXJYBRYIB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |