About methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate
methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate (PubChem CID 137100209) has the molecular formula C19H12N4O4
and a molecular weight of 360.33 g/mol. Its IUPAC name is methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate |
| PubChem CID | 137100209 |
| Molecular Formula | C19H12N4O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2oc(-c3cccc4oc(-c5ncc[nH]5)nc34)nc12 |
| InChI | InChI=1S/C19H12N4O4/c1-25-19(24)11-5-3-7-13-15(11)22-17(26-13)10-4-2-6-12-14(10)23-18(27-12)16-20-8-9-21-16/h2-9H,1H3,(H,20,21) |
| InChIKey | LQZGWXUTHQGYAH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate?
The IUPAC name of methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate (CID 137100209) is methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate.
What is the SMILES notation for methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate?
The canonical SMILES for methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate is COC(=O)c1cccc2oc(-c3cccc4oc(-c5ncc[nH]5)nc34)nc12.
What is the InChIKey of methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate?
The InChIKey is LQZGWXUTHQGYAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N4O4/c1-25-19(24)11-5-3-7-13-15(11)22-17(26-13)10-4-2-6-12-14(10)23-18(27-12)16-20-8-9-21-16/h2-9H,1H3,(H,20,21).
What are the key properties of methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate?
methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate has a molecular weight of 360.33 g/mol, XLogP of 3.81, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(1H-imidazol-2-yl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate is sourced from PubChem (CID 137100209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).