C12H15FN4 — CID 137100268
N-ethylidene-6-fluoro-N'-methyl-1,4,7,8-tetrahydropyrrolo[2,3-b]azepine-3-carboximidamide (PubChem CID 137100268) has the molecular formula C12H15FN4 and a molecular weight of 234.28 g/mol. Its IUPAC name is N-ethylidene-6-fluoro-N'-methyl-1,4,7,8-tetrahydropyrrolo[2,3-b]azepine-3-carboximidamide.
| Compound Name | N-ethylidene-6-fluoro-N'-methyl-1,4,7,8-tetrahydropyrrolo[2,3-b]azepine-3-carboximidamide |
|---|---|
| PubChem CID | 137100268 |
| Molecular Formula | C12H15FN4 |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | N-ethylidene-6-fluoro-N'-methyl-1,4,7,8-tetrahydropyrrolo[2,3-b]azepine-3-carboximidamide |
| SMILES | C/C=N/C(=N\C)c1c[nH]c2c1CC=C(F)CN2 |
| InChI | InChI=1S/C12H15FN4/c1-3-15-11(14-2)10-7-17-12-9(10)5-4-8(13)6-16-12/h3-4,7,16-17H,5-6H2,1-2H3/b14-11-,15-3+ |
| InChIKey | MRXHIMJHAMCZKE-BLFKNDHQSA-N |
| XLogP | 2.30 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|