About 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one
6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one (PubChem CID 137100940) has the molecular formula C15H17BrN2O
and a molecular weight of 321.22 g/mol. Its IUPAC name is 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one |
| PubChem CID | 137100940 |
| Molecular Formula | C15H17BrN2O |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one |
| SMILES | CC1(C)CC[C@H](c2nc3ccc(Br)cc3c(=O)[nH]2)C1 |
| InChI | InChI=1S/C15H17BrN2O/c1-15(2)6-5-9(8-15)13-17-12-4-3-10(16)7-11(12)14(19)18-13/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,18,19)/t9-/m0/s1 |
| InChIKey | XTTYFUSSOOMFAU-VIFPVBQESA-N |
| XLogP | 3.98 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one?
The IUPAC name of 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one (CID 137100940) is 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one.
What is the SMILES notation for 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one?
The canonical SMILES for 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one is CC1(C)CC[C@H](c2nc3ccc(Br)cc3c(=O)[nH]2)C1.
What is the InChIKey of 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one?
The InChIKey is XTTYFUSSOOMFAU-VIFPVBQESA-N. The full InChI is InChI=1S/C15H17BrN2O/c1-15(2)6-5-9(8-15)13-17-12-4-3-10(16)7-11(12)14(19)18-13/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,18,19)/t9-/m0/s1.
What are the key properties of 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one?
6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one has a molecular weight of 321.22 g/mol, XLogP of 3.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-[(1S)-3,3-dimethylcyclopentyl]-3H-quinazolin-4-one is sourced from PubChem (CID 137100940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).