C9H13N3 — CID 137103485
4-ethenyl-N,7-dimethyl-1,7-dihydro-1,3-diazepin-2-imine (PubChem CID 137103485) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-ethenyl-N,7-dimethyl-1,7-dihydro-1,3-diazepin-2-imine.
| Compound Name | 4-ethenyl-N,7-dimethyl-1,7-dihydro-1,3-diazepin-2-imine |
|---|---|
| PubChem CID | 137103485 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 4-ethenyl-N,7-dimethyl-1,7-dihydro-1,3-diazepin-2-imine |
| SMILES | C=CC1=N/C(=N\C)NC(C)C=C1 |
| InChI | InChI=1S/C9H13N3/c1-4-8-6-5-7(2)11-9(10-3)12-8/h4-7H,1H2,2-3H3,(H,10,11) |
| InChIKey | GVQVEZSZPYMCPJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|