About 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one
2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one (PubChem CID 137103510) has the molecular formula C12H11N3O
and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one.
Molecular Properties
| Compound Name | 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one |
| PubChem CID | 137103510 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one |
| SMILES | CCc1cc2[nH]c(=O)c3ccccc3n2n1 |
| InChI | InChI=1S/C12H11N3O/c1-2-8-7-11-13-12(16)9-5-3-4-6-10(9)15(11)14-8/h3-7H,2H2,1H3,(H,13,16) |
| InChIKey | SYIPUYVBJNYZQU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one?
The IUPAC name of 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one (CID 137103510) is 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one.
What is the SMILES notation for 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one?
The canonical SMILES for 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one is CCc1cc2[nH]c(=O)c3ccccc3n2n1.
What is the InChIKey of 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one?
The InChIKey is SYIPUYVBJNYZQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O/c1-2-8-7-11-13-12(16)9-5-3-4-6-10(9)15(11)14-8/h3-7H,2H2,1H3,(H,13,16).
What are the key properties of 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one?
2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one has a molecular weight of 213.24 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4H-pyrazolo[1,5-a]quinazolin-5-one is sourced from PubChem (CID 137103510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).