C10H17N5O3 — CID 137103756
(6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-6-methyl-3,5,7,8-tetrahydropteridin-4-one (PubChem CID 137103756) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-6-methyl-3,5,7,8-tetrahydropteridin-4-one.
| Compound Name | (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-6-methyl-3,5,7,8-tetrahydropteridin-4-one |
|---|---|
| PubChem CID | 137103756 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-6-methyl-3,5,7,8-tetrahydropteridin-4-one |
| SMILES | C[C@H](O)[C@H](O)[C@@]1(C)CNc2nc(N)[nH]c(=O)c2N1 |
| InChI | InChI=1S/C10H17N5O3/c1-4(16)6(17)10(2)3-12-7-5(15-10)8(18)14-9(11)13-7/h4,6,15-17H,3H2,1-2H3,(H4,11,12,13,14,18)/t4-,6-,10+/m0/s1 |
| InChIKey | ZXWOUECXXOIJEE-DMXGEVFUSA-N |
| XLogP | -1.31 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |