C24H26F2N8O3S — CID 137103886
N-[2-(difluoromethoxy)-4-(5-methyl-2,5-diazaspiro[3.4]octan-2-yl)-5-nitrophenyl]-4-[3-(methylamino)thiophene-2-carboximidoyl]pyrimidin-2-amine (PubChem CID 137103886) has the molecular formula C24H26F2N8O3S and a molecular weight of 544.59 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-4-(5-methyl-2,5-diazaspiro[3.4]octan-2-yl)-5-nitrophenyl]-4-[3-(methylamino)thiophene-2-carboximidoyl]pyrimidin-2-amine.
| Compound Name | N-[2-(difluoromethoxy)-4-(5-methyl-2,5-diazaspiro[3.4]octan-2-yl)-5-nitrophenyl]-4-[3-(methylamino)thiophene-2-carboximidoyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 137103886 |
| Molecular Formula | C24H26F2N8O3S |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | N-[2-(difluoromethoxy)-4-(5-methyl-2,5-diazaspiro[3.4]octan-2-yl)-5-nitrophenyl]-4-[3-(methylamino)thiophene-2-carboximidoyl]pyrimidin-2-amine |
| SMILES | [H]/N=C(/c1ccnc(Nc2cc([N+](=O)[O-])c(N3CC4(CCCN4C)C3)cc2OC(F)F)n1)c1sccc1NC |
| InChI | InChI=1S/C24H26F2N8O3S/c1-28-15-5-9-38-21(15)20(27)14-4-7-29-23(30-14)31-16-10-18(34(35)36)17(11-19(16)37-22(25)26)33-12-24(13-33)6-3-8-32(24)2/h4-5,7,9-11,22,27-28H,3,6,8,12-13H2,1-2H3,(H,29,30,31)/b27-20- |
| InChIKey | ADQNKSUZBAWDAK-OOAXWGSJSA-N |
| XLogP | 4.53 |
| TPSA | 132.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|