C15H10F3N3O — CID 137104076
6-amino-2-[3-(trifluoromethyl)phenyl]-3H-quinazolin-4-one (PubChem CID 137104076) has the molecular formula C15H10F3N3O and a molecular weight of 305.26 g/mol. Its IUPAC name is 6-amino-2-[3-(trifluoromethyl)phenyl]-3H-quinazolin-4-one.
| Compound Name | 6-amino-2-[3-(trifluoromethyl)phenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137104076 |
| Molecular Formula | C15H10F3N3O |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 6-amino-2-[3-(trifluoromethyl)phenyl]-3H-quinazolin-4-one |
| SMILES | Nc1ccc2nc(-c3cccc(C(F)(F)F)c3)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C15H10F3N3O/c16-15(17,18)9-3-1-2-8(6-9)13-20-12-5-4-10(19)7-11(12)14(22)21-13/h1-7H,19H2,(H,20,21,22) |
| InChIKey | UKXGDIVHGKVUOV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|