C19H19ClFN3O — CID 137104848
N-[(4-chloro-3-fluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine (PubChem CID 137104848) has the molecular formula C19H19ClFN3O and a molecular weight of 359.83 g/mol. Its IUPAC name is N-[(4-chloro-3-fluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine.
| Compound Name | N-[(4-chloro-3-fluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine |
|---|---|
| PubChem CID | 137104848 |
| Molecular Formula | C19H19ClFN3O |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-[(4-chloro-3-fluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine |
| SMILES | Fc1cc(C/N=C2\Nc3ccccc3NC23CCOCC3)ccc1Cl |
| InChI | InChI=1S/C19H19ClFN3O/c20-14-6-5-13(11-15(14)21)12-22-18-19(7-9-25-10-8-19)24-17-4-2-1-3-16(17)23-18/h1-6,11,24H,7-10,12H2,(H,22,23) |
| InChIKey | HYCNHDBIYLSVFC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|