C20H19Cl2F2N3 — CID 137105203
6,7-dichloro-N-[(2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine (PubChem CID 137105203) has the molecular formula C20H19Cl2F2N3 and a molecular weight of 410.30 g/mol. Its IUPAC name is 6,7-dichloro-N-[(2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine.
| Compound Name | 6,7-dichloro-N-[(2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
|---|---|
| PubChem CID | 137105203 |
| Molecular Formula | C20H19Cl2F2N3 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 6,7-dichloro-N-[(2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
| SMILES | Fc1cccc(F)c1C/N=C1\Nc2cc(Cl)c(Cl)cc2NC12CCCCC2 |
| InChI | InChI=1S/C20H19Cl2F2N3/c21-13-9-17-18(10-14(13)22)27-20(7-2-1-3-8-20)19(26-17)25-11-12-15(23)5-4-6-16(12)24/h4-6,9-10,27H,1-3,7-8,11H2,(H,25,26) |
| InChIKey | JONIIMVCBIPLNP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|