C20H20F3N3O — CID 137105486
N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine (PubChem CID 137105486) has the molecular formula C20H20F3N3O and a molecular weight of 375.39 g/mol. Its IUPAC name is N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine.
| Compound Name | N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine |
|---|---|
| PubChem CID | 137105486 |
| Molecular Formula | C20H20F3N3O |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine |
| SMILES | FC(F)(F)c1cccc(C/N=C2\Nc3ccccc3NC23CCOCC3)c1 |
| InChI | InChI=1S/C20H20F3N3O/c21-20(22,23)15-5-3-4-14(12-15)13-24-18-19(8-10-27-11-9-19)26-17-7-2-1-6-16(17)25-18/h1-7,12,26H,8-11,13H2,(H,24,25) |
| InChIKey | FPXAVNKSRARFTF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|