C13H19NO2 — CID 137105568
2-[[(2R)-1-hydroxy-4-methylpentan-2-yl]iminomethyl]phenol (PubChem CID 137105568) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[[(2R)-1-hydroxy-4-methylpentan-2-yl]iminomethyl]phenol.
| Compound Name | 2-[[(2R)-1-hydroxy-4-methylpentan-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137105568 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-[[(2R)-1-hydroxy-4-methylpentan-2-yl]iminomethyl]phenol |
| SMILES | CC(C)C[C@H](CO)/N=C/c1ccccc1O |
| InChI | InChI=1S/C13H19NO2/c1-10(2)7-12(9-15)14-8-11-5-3-4-6-13(11)16/h3-6,8,10,12,15-16H,7,9H2,1-2H3/b14-8+/t12-/m1/s1 |
| InChIKey | ZYHNHNZCHAHGTR-ZBQKXELDSA-N |
| XLogP | 2.22 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|