C21H18FN7O2 — CID 137105674
(5S)-5-(4-fluorophenyl)-5-methyl-2-(8-propyl-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-3,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione (PubChem CID 137105674) has the molecular formula C21H18FN7O2 and a molecular weight of 419.42 g/mol. Its IUPAC name is (5S)-5-(4-fluorophenyl)-5-methyl-2-(8-propyl-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-3,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione.
| Compound Name | (5S)-5-(4-fluorophenyl)-5-methyl-2-(8-propyl-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-3,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 137105674 |
| Molecular Formula | C21H18FN7O2 |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (5S)-5-(4-fluorophenyl)-5-methyl-2-(8-propyl-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-3,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione |
| SMILES | CCCc1nc(-c2nc3c(c(=O)[nH]2)[C@](C)(c2ccc(F)cc2)C(=O)N3)cn2ncnc12 |
| InChI | InChI=1S/C21H18FN7O2/c1-3-4-13-18-23-10-24-29(18)9-14(25-13)16-26-17-15(19(30)27-16)21(2,20(31)28-17)11-5-7-12(22)8-6-11/h5-10H,3-4H2,1-2H3,(H2,26,27,28,30,31)/t21-/m0/s1 |
| InChIKey | QZVDNDBVKIRAMV-NRFANRHFSA-N |
| XLogP | 2.22 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |