C26H24ClN5O3 — CID 137105931
(3aR,7aR)-2-[(5R,7S)-5-(4-chlorophenyl)-7-(2-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 137105931) has the molecular formula C26H24ClN5O3 and a molecular weight of 489.96 g/mol. Its IUPAC name is (3aR,7aR)-2-[(5R,7S)-5-(4-chlorophenyl)-7-(2-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[(5R,7S)-5-(4-chlorophenyl)-7-(2-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 137105931 |
| Molecular Formula | C26H24ClN5O3 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (3aR,7aR)-2-[(5R,7S)-5-(4-chlorophenyl)-7-(2-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COc1ccccc1[C@@H]1C[C@H](c2ccc(Cl)cc2)Nc2nc(N3C(=O)[C@@H]4CC=CC[C@H]4C3=O)nn21 |
| InChI | InChI=1S/C26H24ClN5O3/c1-35-22-9-5-4-8-19(22)21-14-20(15-10-12-16(27)13-11-15)28-25-29-26(30-32(21)25)31-23(33)17-6-2-3-7-18(17)24(31)34/h2-5,8-13,17-18,20-21H,6-7,14H2,1H3,(H,28,29,30)/t17-,18-,20-,21+/m1/s1 |
| InChIKey | RAZORPDCNBPKQT-UKAVVXHISA-N |
| XLogP | 4.54 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|