About [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate
[(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate (PubChem CID 137106918) has the molecular formula C23H18BrN3O3
and a molecular weight of 464.32 g/mol. Its IUPAC name is [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate.
Molecular Properties
| Compound Name | [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate |
| PubChem CID | 137106918 |
| Molecular Formula | C23H18BrN3O3 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate |
| SMILES | C#CCC(C)(C)C(=O)O/N=C1/C(c2c(O)[nH]c3cc(Br)ccc23)=Nc2ccccc21 |
| InChI | InChI=1S/C23H18BrN3O3/c1-4-11-23(2,3)22(29)30-27-19-15-7-5-6-8-16(15)25-20(19)18-14-10-9-13(24)12-17(14)26-21(18)28/h1,5-10,12,26,28H,11H2,2-3H3/b27-19+ |
| InChIKey | ORMWOCNZTZSTDA-ZXVVBBHZSA-N |
| XLogP | 5.07 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate?
The IUPAC name of [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate (CID 137106918) is [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate.
What is the SMILES notation for [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate?
The canonical SMILES for [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate is C#CCC(C)(C)C(=O)O/N=C1/C(c2c(O)[nH]c3cc(Br)ccc23)=Nc2ccccc21.
What is the InChIKey of [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate?
The InChIKey is ORMWOCNZTZSTDA-ZXVVBBHZSA-N. The full InChI is InChI=1S/C23H18BrN3O3/c1-4-11-23(2,3)22(29)30-27-19-15-7-5-6-8-16(15)25-20(19)18-14-10-9-13(24)12-17(14)26-21(18)28/h1,5-10,12,26,28H,11H2,2-3H3/b27-19+.
What are the key properties of [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate?
[(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate has a molecular weight of 464.32 g/mol, XLogP of 5.07, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino] 2,2-dimethylpent-4-ynoate is sourced from PubChem (CID 137106918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).