C15H25N5O2 — CID 137108587
(2R)-N-[2-(4-amino-6-oxo-1H-pyrimidin-2-yl)ethyl]-2-(azepan-1-yl)propanamide (PubChem CID 137108587) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is (2R)-N-[2-(4-amino-6-oxo-1H-pyrimidin-2-yl)ethyl]-2-(azepan-1-yl)propanamide.
| Compound Name | (2R)-N-[2-(4-amino-6-oxo-1H-pyrimidin-2-yl)ethyl]-2-(azepan-1-yl)propanamide |
|---|---|
| PubChem CID | 137108587 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (2R)-N-[2-(4-amino-6-oxo-1H-pyrimidin-2-yl)ethyl]-2-(azepan-1-yl)propanamide |
| SMILES | C[C@H](C(=O)NCCc1nc(N)cc(=O)[nH]1)N1CCCCCC1 |
| InChI | InChI=1S/C15H25N5O2/c1-11(20-8-4-2-3-5-9-20)15(22)17-7-6-13-18-12(16)10-14(21)19-13/h10-11H,2-9H2,1H3,(H,17,22)(H3,16,18,19,21)/t11-/m1/s1 |
| InChIKey | ZIPZFWSYKCMBOH-LLVKDONJSA-N |
| XLogP | 0.28 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |